CAS No: 82925-01-7, Chemical Name: 6,7-dimethoxy-2-[2-(4-nitrophenyl)ethyl]-1,2,3,4-tetrahydroisoquinoline
the physical and chemical property of 82925-01-7, 6,7-dimethoxy-2-[2-(4-nitrophenyl)ethyl]-1,2,3,4-tetrahydroisoquinoline is provided by ChemNet.com
ChemNet > CAS > 82925-01-7 6,7-dimethoxy-2-[2-(4-nitrophenyl)ethyl]-1,2,3,4-tetrahydroisoquinoline
82925-01-7 6,7-dimethoxy-2-[2-(4-nitrophenyl)ethyl]-1,2,3,4-tetrahydroisoquinoline
상품명칭 |
6,7-dimethoxy-2-[2-(4-nitrophenyl)ethyl]-1,2,3,4-tetrahydroisoquinoline |
별명 |
1,2,3,4-Tetrahydro-6,7-dimethoxy-2-[2-(4-nitrophenyl)ethyl]isoquinoline |
분자식 |
C19H22N2O4 |
분자량 |
342.389 |
InChI |
InChI=1/C19H22N2O4/c1-24-18-11-15-8-10-20(13-16(15)12-19(18)25-2)9-7-14-3-5-17(6-4-14)21(22)23/h3-6,11-12H,7-10,13H2,1-2H3 |
cas번호 |
82925-01-7 |
분자 구조 |
|
밀도 |
1.199g/cm3 |
비등점 |
496.2°C at 760 mmHg |
굴절 지수 |
1.585 |
인화점 |
253.9°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
|
|